C18H26N6 — CID 112908336
N-butyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112908336) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is N-butyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-butyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112908336 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | N-butyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CCCCNc1nc(C)cc(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C18H26N6/c1-3-4-8-20-18-21-15(2)14-17(22-18)24-12-10-23(11-13-24)16-7-5-6-9-19-16/h5-7,9,14H,3-4,8,10-13H2,1-2H3,(H,20,21,22) |
| InChIKey | DTFMZWFXKOAXLV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|