C19H32N6O2S — CID 122348324
N-cyclohexyl-4-methyl-6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 122348324) has the molecular formula C19H32N6O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-4-methyl-6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 122348324 |
| Molecular Formula | C19H32N6O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-cyclohexyl-4-methyl-6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)N3CCCC3)CC2)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C19H32N6O2S/c1-16-15-18(22-19(20-16)21-17-7-3-2-4-8-17)23-11-13-25(14-12-23)28(26,27)24-9-5-6-10-24/h15,17H,2-14H2,1H3,(H,20,21,22) |
| InChIKey | LRSGXKZIIGTAEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |