C21H29N5O2S — CID 50945908
4-[4-(benzenesulfonyl)piperazin-1-yl]-N-cyclohexyl-6-methylpyrimidin-2-amine (PubChem CID 50945908) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-cyclohexyl-6-methylpyrimidin-2-amine.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-cyclohexyl-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 50945908 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-cyclohexyl-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccccc3)CC2)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C21H29N5O2S/c1-17-16-20(24-21(22-17)23-18-8-4-2-5-9-18)25-12-14-26(15-13-25)29(27,28)19-10-6-3-7-11-19/h3,6-7,10-11,16,18H,2,4-5,8-9,12-15H2,1H3,(H,22,23,24) |
| InChIKey | PXGBOKFIVFSGSM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |