C23H31N5 — CID 112884982
N-cyclohexyl-4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-2-amine (PubChem CID 112884982) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112884982 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | N-cyclohexyl-4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-2-amine |
| SMILES | C(=C/c1ccccc1)\CN1CCN(c2ccnc(NC3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C23H31N5/c1-3-8-20(9-4-1)10-7-15-27-16-18-28(19-17-27)22-13-14-24-23(26-22)25-21-11-5-2-6-12-21/h1,3-4,7-10,13-14,21H,2,5-6,11-12,15-19H2,(H,24,25,26)/b10-7+ |
| InChIKey | BAIRFTBOMFYCPI-JXMROGBWSA-N |
| XLogP | 4.06 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |