C22H29N3 — CID 142637683
1-[[(1R,3R)-3-phenylcyclohexyl]methyl]-4-pyridin-2-ylpiperazine (PubChem CID 142637683) has the molecular formula C22H29N3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[[(1R,3R)-3-phenylcyclohexyl]methyl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[[(1R,3R)-3-phenylcyclohexyl]methyl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 142637683 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 1-[[(1R,3R)-3-phenylcyclohexyl]methyl]-4-pyridin-2-ylpiperazine |
| SMILES | c1ccc([C@@H]2CCC[C@@H](CN3CCN(c4ccccn4)CC3)C2)cc1 |
| InChI | InChI=1S/C22H29N3/c1-2-8-20(9-3-1)21-10-6-7-19(17-21)18-24-13-15-25(16-14-24)22-11-4-5-12-23-22/h1-5,8-9,11-12,19,21H,6-7,10,13-18H2/t19-,21-/m1/s1 |
| InChIKey | INALOXAUZSKWLF-TZIWHRDSSA-N |
| XLogP | 4.18 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |