C22H44N4 — CID 171070111
ethane;1-methyl-4-[(1-pyridin-2-ylpiperidin-4-yl)methyl]piperazine (PubChem CID 171070111) has the molecular formula C22H44N4 and a molecular weight of 364.62 g/mol. Its IUPAC name is ethane;1-methyl-4-[(1-pyridin-2-ylpiperidin-4-yl)methyl]piperazine.
| Compound Name | ethane;1-methyl-4-[(1-pyridin-2-ylpiperidin-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171070111 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | ethane;1-methyl-4-[(1-pyridin-2-ylpiperidin-4-yl)methyl]piperazine |
| SMILES | CC.CC.CC.CN1CCN(CC2CCN(c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C16H26N4.3C2H6/c1-18-10-12-19(13-11-18)14-15-5-8-20(9-6-15)16-4-2-3-7-17-16;3*1-2/h2-4,7,15H,5-6,8-14H2,1H3;3*1-2H3 |
| InChIKey | QAGLYLSYMMQVAC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |