C11H19Cl2N3 — CID 140971287
(1-pyridin-2-ylpiperidin-4-yl)methanamine;dihydrochloride (PubChem CID 140971287) has the molecular formula C11H19Cl2N3 and a molecular weight of 264.20 g/mol. Its IUPAC name is (1-pyridin-2-ylpiperidin-4-yl)methanamine;dihydrochloride.
| Compound Name | (1-pyridin-2-ylpiperidin-4-yl)methanamine;dihydrochloride |
|---|---|
| PubChem CID | 140971287 |
| Molecular Formula | C11H19Cl2N3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (1-pyridin-2-ylpiperidin-4-yl)methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C11H17N3.2ClH/c12-9-10-4-7-14(8-5-10)11-3-1-2-6-13-11;;/h1-3,6,10H,4-5,7-9,12H2;2*1H |
| InChIKey | YTXGSFMENNCKHG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |