C9H14ClN3 — CID 71643959
(3S)-1-pyridin-2-ylpyrrolidin-3-amine;hydrochloride (PubChem CID 71643959) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is (3S)-1-pyridin-2-ylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-pyridin-2-ylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71643959 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | (3S)-1-pyridin-2-ylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C9H13N3.ClH/c10-8-4-6-12(7-8)9-3-1-2-5-11-9;/h1-3,5,8H,4,6-7,10H2;1H/t8-;/m0./s1 |
| InChIKey | BSJVWLOHGGEFER-QRPNPIFTSA-N |
| XLogP | 1.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |