C22H36N12 — CID 58949154
(3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(4-pyridin-2-ylpiperazin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58949154) has the molecular formula C22H36N12 and a molecular weight of 468.61 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(4-pyridin-2-ylpiperazin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(4-pyridin-2-ylpiperazin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58949154 |
| Molecular Formula | C22H36N12 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(4-pyridin-2-ylpiperazin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(N3CCN(c4ccccn4)CC3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C22H36N12/c23-15-9-16(24)12-33(11-15)21-28-20(29-22(30-21)34-13-17(25)10-18(26)14-34)32-7-5-31(6-8-32)19-3-1-2-4-27-19/h1-4,15-18H,5-14,23-26H2/t15-,16+,17-,18+ |
| InChIKey | FLJFQJSYEQTNIE-USTZCAOPSA-N |
| XLogP | -1.68 |
| TPSA | 168.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |