C17H18N6 — CID 4907991
2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 4907991) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine.
| Compound Name | 2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 4907991 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | Nc1nc(N2CCN(c3ccccn3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C17H18N6/c18-16-13-5-1-2-6-14(13)20-17(21-16)23-11-9-22(10-12-23)15-7-3-4-8-19-15/h1-8H,9-12H2,(H2,18,20,21) |
| InChIKey | YBDJTGPYUZXNJE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |