C14H16N8 — CID 117079664
2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine (PubChem CID 117079664) has the molecular formula C14H16N8 and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine.
| Compound Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117079664 |
| Molecular Formula | C14H16N8 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine |
| SMILES | Nc1nc(N2CCN(c3ccccn3)CC2)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H16N8/c15-12-11-13(18-9-17-11)20-14(19-12)22-7-5-21(6-8-22)10-3-1-2-4-16-10/h1-4,9H,5-8H2,(H3,15,17,18,19,20) |
| InChIKey | MQSUMWNXIJEVCO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |