C13H17N7 — CID 78910390
6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine (PubChem CID 78910390) has the molecular formula C13H17N7 and a molecular weight of 271.33 g/mol. Its IUPAC name is 6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 78910390 |
| Molecular Formula | C13H17N7 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(N2CCN(c3ccccn3)CC2)nc(N)n1 |
| InChI | InChI=1S/C13H17N7/c14-10-9-12(18-13(15)17-10)20-7-5-19(6-8-20)11-3-1-2-4-16-11/h1-4,9H,5-8H2,(H4,14,15,17,18) |
| InChIKey | FXSDADGWGOHWNH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |