C15H20N6 — CID 80757583
2,5-dimethyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 80757583) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2,5-dimethyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 2,5-dimethyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80757583 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2,5-dimethyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1nc(N)c(C)c(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C15H20N6/c1-11-14(16)18-12(2)19-15(11)21-9-7-20(8-10-21)13-5-3-4-6-17-13/h3-6H,7-10H2,1-2H3,(H2,16,18,19) |
| InChIKey | HKFUGYVCFDMCEK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |