C13H17N5S — CID 103362422
4-methyl-5-(4-pyridin-2-ylpiperazin-1-yl)-1,2-thiazol-3-amine (PubChem CID 103362422) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 4-methyl-5-(4-pyridin-2-ylpiperazin-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-methyl-5-(4-pyridin-2-ylpiperazin-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103362422 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-methyl-5-(4-pyridin-2-ylpiperazin-1-yl)-1,2-thiazol-3-amine |
| SMILES | Cc1c(N)nsc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C13H17N5S/c1-10-12(14)16-19-13(10)18-8-6-17(7-9-18)11-4-2-3-5-15-11/h2-5H,6-9H2,1H3,(H2,14,16) |
| InChIKey | LSPWEQOYWXJQAR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |