C22H24N8O — CID 117080800
N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine (PubChem CID 117080800) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine.
| Compound Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117080800 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-7H-purin-6-amine |
| SMILES | c1ccc(OCCNc2nc(N3CCN(c4ccccn4)CC3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C22H24N8O/c1-2-6-17(7-3-1)31-15-10-24-20-19-21(26-16-25-19)28-22(27-20)30-13-11-29(12-14-30)18-8-4-5-9-23-18/h1-9,16H,10-15H2,(H2,24,25,26,27,28) |
| InChIKey | RWFNPDBOHZMVLI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|