C26H32N8O — CID 117092021
N-[2-(4-methoxyphenyl)ethyl]-9-propan-2-yl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine (PubChem CID 117092021) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-9-propan-2-yl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-9-propan-2-yl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 117092021 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-9-propan-2-yl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine |
| SMILES | COc1ccc(CCNc2nc(N3CCN(c4ccccn4)CC3)nc3c2ncn3C(C)C)cc1 |
| InChI | InChI=1S/C26H32N8O/c1-19(2)34-18-29-23-24(28-13-11-20-7-9-21(35-3)10-8-20)30-26(31-25(23)34)33-16-14-32(15-17-33)22-6-4-5-12-27-22/h4-10,12,18-19H,11,13-17H2,1-3H3,(H,28,30,31) |
| InChIKey | LHSYNWJAERMXEZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |