C28H28N8O — CID 117084685
N-(2-phenoxyethyl)-9-phenyl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine (PubChem CID 117084685) has the molecular formula C28H28N8O and a molecular weight of 492.59 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-9-phenyl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine.
| Compound Name | N-(2-phenoxyethyl)-9-phenyl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 117084685 |
| Molecular Formula | C28H28N8O |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-(2-phenoxyethyl)-9-phenyl-2-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine |
| SMILES | c1ccc(OCCNc2nc(N3CCN(c4ccccn4)CC3)nc3c2ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N8O/c1-3-9-22(10-4-1)36-21-31-25-26(30-15-20-37-23-11-5-2-6-12-23)32-28(33-27(25)36)35-18-16-34(17-19-35)24-13-7-8-14-29-24/h1-14,21H,15-20H2,(H,30,32,33) |
| InChIKey | PFEBFPNKGXXAGY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|