C24H23N9S — CID 117083214
N-(pyridin-3-ylmethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-thiophen-3-ylpurin-6-amine (PubChem CID 117083214) has the molecular formula C24H23N9S and a molecular weight of 469.58 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-thiophen-3-ylpurin-6-amine.
| Compound Name | N-(pyridin-3-ylmethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-thiophen-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 117083214 |
| Molecular Formula | C24H23N9S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-thiophen-3-ylpurin-6-amine |
| SMILES | c1ccc(N2CCN(c3nc(NCc4cccnc4)c4ncn(-c5ccsc5)c4n3)CC2)nc1 |
| InChI | InChI=1S/C24H23N9S/c1-2-8-26-20(5-1)31-9-11-32(12-10-31)24-29-22(27-15-18-4-3-7-25-14-18)21-23(30-24)33(17-28-21)19-6-13-34-16-19/h1-8,13-14,16-17H,9-12,15H2,(H,27,29,30) |
| InChIKey | KGJKYIMAMWCRQA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |