C22H17N5S — CID 117081803
N-benzyl-2-phenyl-9-thiophen-3-ylpurin-6-amine (PubChem CID 117081803) has the molecular formula C22H17N5S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-benzyl-2-phenyl-9-thiophen-3-ylpurin-6-amine.
| Compound Name | N-benzyl-2-phenyl-9-thiophen-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 117081803 |
| Molecular Formula | C22H17N5S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-benzyl-2-phenyl-9-thiophen-3-ylpurin-6-amine |
| SMILES | c1ccc(CNc2nc(-c3ccccc3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C22H17N5S/c1-3-7-16(8-4-1)13-23-21-19-22(27(15-24-19)18-11-12-28-14-18)26-20(25-21)17-9-5-2-6-10-17/h1-12,14-15H,13H2,(H,23,25,26) |
| InChIKey | BZOKYOWXCYFQBB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |