C17H16N6OS — CID 117091353
2-[[2-(3-aminophenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethanol (PubChem CID 117091353) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-[[2-(3-aminophenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethanol.
| Compound Name | 2-[[2-(3-aminophenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 117091353 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[[2-(3-aminophenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethanol |
| SMILES | Nc1cccc(-c2nc(NCCO)c3ncn(-c4ccsc4)c3n2)c1 |
| InChI | InChI=1S/C17H16N6OS/c18-12-3-1-2-11(8-12)15-21-16(19-5-6-24)14-17(22-15)23(10-20-14)13-4-7-25-9-13/h1-4,7-10,24H,5-6,18H2,(H,19,21,22) |
| InChIKey | YLFSBRALXVSHHN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|