C25H27N7O2 — CID 117079256
[4-[6-(2-hydroxyethylamino)-9-phenylpurin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 117079256) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is [4-[6-(2-hydroxyethylamino)-9-phenylpurin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[6-(2-hydroxyethylamino)-9-phenylpurin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 117079256 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [4-[6-(2-hydroxyethylamino)-9-phenylpurin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(-c3nc(NCCO)c4ncn(-c5ccccc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C25H27N7O2/c1-30-12-14-31(15-13-30)25(34)19-9-7-18(8-10-19)22-28-23(26-11-16-33)21-24(29-22)32(17-27-21)20-5-3-2-4-6-20/h2-10,17,33H,11-16H2,1H3,(H,26,28,29) |
| InChIKey | NJMQQHWEGDZQTD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |