C31H36N8O3 — CID 117080612
1-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117080612) has the molecular formula C31H36N8O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is 1-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117080612 |
| Molecular Formula | C31H36N8O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 1-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | CN1CCN(C(=O)c2ccc(-c3nc(NCCOc4ccccc4)c4ncn(CCN5CCCC5=O)c4n3)cc2)CC1 |
| InChI | InChI=1S/C31H36N8O3/c1-36-15-17-38(18-16-36)31(41)24-11-9-23(10-12-24)28-34-29(32-13-21-42-25-6-3-2-4-7-25)27-30(35-28)39(22-33-27)20-19-37-14-5-8-26(37)40/h2-4,6-7,9-12,22H,5,8,13-21H2,1H3,(H,32,34,35) |
| InChIKey | QWHPTWZLXJOFBK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|