C27H36N8O2 — CID 117081557
1-[3-[[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117081557) has the molecular formula C27H36N8O2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 1-[3-[[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117081557 |
| Molecular Formula | C27H36N8O2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 1-[3-[[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC(C)n1cnc2c(NCCCN3CCCC3=O)nc(-c3ccc(C(=O)N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C27H36N8O2/c1-19(2)35-18-29-23-25(28-11-5-13-33-12-4-6-22(33)36)30-24(31-26(23)35)20-7-9-21(10-8-20)27(37)34-16-14-32(3)15-17-34/h7-10,18-19H,4-6,11-17H2,1-3H3,(H,28,30,31) |
| InChIKey | BNWWBPDVNNVCLE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|