C21H27N7O — CID 117080647
1-[3-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117080647) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 1-[3-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117080647 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-[3-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC(C)n1cnc2c(NCCCN3CCCC3=O)nc(-c3cccc(N)c3)nc21 |
| InChI | InChI=1S/C21H27N7O/c1-14(2)28-13-24-18-20(23-9-5-11-27-10-4-8-17(27)29)25-19(26-21(18)28)15-6-3-7-16(22)12-15/h3,6-7,12-14H,4-5,8-11,22H2,1-2H3,(H,23,25,26) |
| InChIKey | QBSQVJXIWVBVGP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|