C25H25N7O2 — CID 117082227
4-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]-9-phenylpurin-2-yl]benzamide (PubChem CID 117082227) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 4-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]-9-phenylpurin-2-yl]benzamide.
| Compound Name | 4-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]-9-phenylpurin-2-yl]benzamide |
|---|---|
| PubChem CID | 117082227 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]-9-phenylpurin-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nc(NCCCN3CCCC3=O)c3ncn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C25H25N7O2/c26-22(34)17-9-11-18(12-10-17)23-29-24(27-13-5-15-31-14-4-8-20(31)33)21-25(30-23)32(16-28-21)19-6-2-1-3-7-19/h1-3,6-7,9-12,16H,4-5,8,13-15H2,(H2,26,34)(H,27,29,30) |
| InChIKey | SFCFXMIJDSCUMR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|