C28H24N6O — CID 117086485
4-[6-(benzylamino)-9-phenylpurin-2-yl]-N-cyclopropylbenzamide (PubChem CID 117086485) has the molecular formula C28H24N6O and a molecular weight of 460.54 g/mol. Its IUPAC name is 4-[6-(benzylamino)-9-phenylpurin-2-yl]-N-cyclopropylbenzamide.
| Compound Name | 4-[6-(benzylamino)-9-phenylpurin-2-yl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 117086485 |
| Molecular Formula | C28H24N6O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-[6-(benzylamino)-9-phenylpurin-2-yl]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2nc(NCc3ccccc3)c3ncn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C28H24N6O/c35-28(31-22-15-16-22)21-13-11-20(12-14-21)25-32-26(29-17-19-7-3-1-4-8-19)24-27(33-25)34(18-30-24)23-9-5-2-6-10-23/h1-14,18,22H,15-17H2,(H,31,35)(H,29,32,33) |
| InChIKey | CFAKCGJLAQDTAK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |