C20H20N6 — CID 117091533
6-N-benzyl-2-N-ethyl-9-phenylpurine-2,6-diamine (PubChem CID 117091533) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-N-benzyl-2-N-ethyl-9-phenylpurine-2,6-diamine.
| Compound Name | 6-N-benzyl-2-N-ethyl-9-phenylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117091533 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 6-N-benzyl-2-N-ethyl-9-phenylpurine-2,6-diamine |
| SMILES | CCNc1nc(NCc2ccccc2)c2ncn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H20N6/c1-2-21-20-24-18(22-13-15-9-5-3-6-10-15)17-19(25-20)26(14-23-17)16-11-7-4-8-12-16/h3-12,14H,2,13H2,1H3,(H2,21,22,24,25) |
| InChIKey | ZGEJWZSGOJHGSX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |