C15H18N6O — CID 169445059
2-[[6-(benzylamino)-9-(trideuteriomethyl)purin-2-yl]amino]ethanol (PubChem CID 169445059) has the molecular formula C15H18N6O and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[[6-(benzylamino)-9-(trideuteriomethyl)purin-2-yl]amino]ethanol.
| Compound Name | 2-[[6-(benzylamino)-9-(trideuteriomethyl)purin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 169445059 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[[6-(benzylamino)-9-(trideuteriomethyl)purin-2-yl]amino]ethanol |
| SMILES | [2H]C([2H])([2H])n1cnc2c(NCc3ccccc3)nc(NCCO)nc21 |
| InChI | InChI=1S/C15H18N6O/c1-21-10-18-12-13(17-9-11-5-3-2-4-6-11)19-15(16-7-8-22)20-14(12)21/h2-6,10,22H,7-9H2,1H3,(H2,16,17,19,20)/i1D3 |
| InChIKey | GTVPOLSIJWJJNY-FIBGUPNXSA-N |
| XLogP | 1.38 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |