C18H23N7O — CID 143547216
6-N-benzyl-2-N-(2-nitrosopropyl)-9-propan-2-ylpurine-2,6-diamine (PubChem CID 143547216) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-N-benzyl-2-N-(2-nitrosopropyl)-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-benzyl-2-N-(2-nitrosopropyl)-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 143547216 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 6-N-benzyl-2-N-(2-nitrosopropyl)-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(CNc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1)N=O |
| InChI | InChI=1S/C18H23N7O/c1-12(2)25-11-21-15-16(19-10-14-7-5-4-6-8-14)22-18(23-17(15)25)20-9-13(3)24-26/h4-8,11-13H,9-10H2,1-3H3,(H2,19,20,22,23) |
| InChIKey | JDXRRFFWMPMNCF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |