C23H24N6O2 — CID 117080713
2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117080713) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117080713 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(NCc3ccccc3)nc(NCc3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C23H24N6O2/c1-15(2)29-13-26-20-21(24-11-16-6-4-3-5-7-16)27-23(28-22(20)29)25-12-17-8-9-18-19(10-17)31-14-30-18/h3-10,13,15H,11-12,14H2,1-2H3,(H2,24,25,27,28) |
| InChIKey | JISPQAWTVURMBE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |