C20H24N6O3 — CID 10960266
N-(1,3-benzodioxol-5-ylmethyl)-6-morpholin-4-yl-9-propan-2-ylpurin-2-amine (PubChem CID 10960266) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-morpholin-4-yl-9-propan-2-ylpurin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-morpholin-4-yl-9-propan-2-ylpurin-2-amine |
|---|---|
| PubChem CID | 10960266 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-morpholin-4-yl-9-propan-2-ylpurin-2-amine |
| SMILES | CC(C)n1cnc2c(N3CCOCC3)nc(NCc3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C20H24N6O3/c1-13(2)26-11-22-17-18(25-5-7-27-8-6-25)23-20(24-19(17)26)21-10-14-3-4-15-16(9-14)29-12-28-15/h3-4,9,11,13H,5-8,10,12H2,1-2H3,(H,21,23,24) |
| InChIKey | DFECZZBJMSJXBA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |