C27H31N7O2 — CID 117081191
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-9-propan-2-ylpurin-6-amine (PubChem CID 117081191) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 117081191 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(NCc3ccccc3)nc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)nc21 |
| InChI | InChI=1S/C27H31N7O2/c1-19(2)34-17-29-24-25(28-15-20-6-4-3-5-7-20)30-27(31-26(24)34)33-12-10-32(11-13-33)16-21-8-9-22-23(14-21)36-18-35-22/h3-9,14,17,19H,10-13,15-16,18H2,1-2H3,(H,28,30,31) |
| InChIKey | FAFXBBRVONSUCW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |