C22H27N7O3 — CID 155542199
(E)-N-hydroxy-3-[4-[[(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 155542199) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[[(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[[(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155542199 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[[(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | CC(C)n1cnc2c(NCc3ccc(/C=C/C(=O)NO)cc3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C22H27N7O3/c1-15(2)29-14-24-19-20(25-22(26-21(19)29)28-9-11-32-12-10-28)23-13-17-5-3-16(4-6-17)7-8-18(30)27-31/h3-8,14-15,31H,9-13H2,1-2H3,(H,27,30)(H,23,25,26)/b8-7+ |
| InChIKey | PEOGWPBLYOWJGS-BQYQJAHWSA-N |
| XLogP | 2.37 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|