C20H27N7O2 — CID 71579158
2-methoxy-6-[[(2-piperazin-1-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenol (PubChem CID 71579158) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-methoxy-6-[[(2-piperazin-1-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenol.
| Compound Name | 2-methoxy-6-[[(2-piperazin-1-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 71579158 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-methoxy-6-[[(2-piperazin-1-yl-9-propan-2-ylpurin-6-yl)amino]methyl]phenol |
| SMILES | COc1cccc(CNc2nc(N3CCNCC3)nc3c2ncn3C(C)C)c1O |
| InChI | InChI=1S/C20H27N7O2/c1-13(2)27-12-23-16-18(22-11-14-5-4-6-15(29-3)17(14)28)24-20(25-19(16)27)26-9-7-21-8-10-26/h4-6,12-13,21,28H,7-11H2,1-3H3,(H,22,24,25) |
| InChIKey | WNGBFCDSTYVCFL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|