C18H22ClN7 — CID 10429330
N-(3-chlorophenyl)-2-piperazin-1-yl-9-propan-2-ylpurin-6-amine (PubChem CID 10429330) has the molecular formula C18H22ClN7 and a molecular weight of 371.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-piperazin-1-yl-9-propan-2-ylpurin-6-amine.
| Compound Name | N-(3-chlorophenyl)-2-piperazin-1-yl-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 10429330 |
| Molecular Formula | C18H22ClN7 |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-(3-chlorophenyl)-2-piperazin-1-yl-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(Nc3cccc(Cl)c3)nc(N3CCNCC3)nc21 |
| InChI | InChI=1S/C18H22ClN7/c1-12(2)26-11-21-15-16(22-14-5-3-4-13(19)10-14)23-18(24-17(15)26)25-8-6-20-7-9-25/h3-5,10-12,20H,6-9H2,1-2H3,(H,22,23,24) |
| InChIKey | QRFSBMQEYFWRSG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |