C14H13BrIN5 — CID 10647526
N-(3-bromophenyl)-2-iodo-9-propan-2-ylpurin-6-amine (PubChem CID 10647526) has the molecular formula C14H13BrIN5 and a molecular weight of 458.10 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-iodo-9-propan-2-ylpurin-6-amine.
| Compound Name | N-(3-bromophenyl)-2-iodo-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 10647526 |
| Molecular Formula | C14H13BrIN5 |
| Molecular Weight | 458.10 g/mol |
| Exact Mass | 456.94 |
| IUPAC Name | N-(3-bromophenyl)-2-iodo-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(Nc3cccc(Br)c3)nc(I)nc21 |
| InChI | InChI=1S/C14H13BrIN5/c1-8(2)21-7-17-11-12(19-14(16)20-13(11)21)18-10-5-3-4-9(15)6-10/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | HPPOCVXCOVVNJO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.10 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|