C16H20N6 — CID 117086621
2-N-ethyl-6-N-phenyl-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117086621) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-N-ethyl-6-N-phenyl-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-phenyl-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117086621 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-N-ethyl-6-N-phenyl-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CCNc1nc(Nc2ccccc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C16H20N6/c1-4-17-16-20-14(19-12-8-6-5-7-9-12)13-15(21-16)22(10-18-13)11(2)3/h5-11H,4H2,1-3H3,(H2,17,19,20,21) |
| InChIKey | FSUBQBXNMLODDC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |