C17H20N6 — CID 117080255
6-N-cyclopropyl-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117080255) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 6-N-cyclopropyl-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-cyclopropyl-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117080255 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-N-cyclopropyl-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(NC3CC3)nc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C17H20N6/c1-11(2)23-10-18-14-15(19-13-8-9-13)21-17(22-16(14)23)20-12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | CZTIVXORYVKARG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |