C19H19N5S — CID 117079072
2-(1-benzothiophen-3-yl)-N-cyclopropyl-9-propan-2-ylpurin-6-amine (PubChem CID 117079072) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-cyclopropyl-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-cyclopropyl-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 117079072 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-cyclopropyl-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(NC3CC3)nc(-c3csc4ccccc34)nc21 |
| InChI | InChI=1S/C19H19N5S/c1-11(2)24-10-20-16-18(21-12-7-8-12)22-17(23-19(16)24)14-9-25-15-6-4-3-5-13(14)15/h3-6,9-12H,7-8H2,1-2H3,(H,21,22,23) |
| InChIKey | DVWQORNVIAYCEL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |