C33H36N6O2S — CID 159505908
[3-[3-[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]propyl]-1H-indol-5-yl] 6-aminohexanoate (PubChem CID 159505908) has the molecular formula C33H36N6O2S and a molecular weight of 580.76 g/mol. Its IUPAC name is [3-[3-[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]propyl]-1H-indol-5-yl] 6-aminohexanoate.
| Compound Name | [3-[3-[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]propyl]-1H-indol-5-yl] 6-aminohexanoate |
|---|---|
| PubChem CID | 159505908 |
| Molecular Formula | C33H36N6O2S |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | [3-[3-[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]propyl]-1H-indol-5-yl] 6-aminohexanoate |
| SMILES | CC(C)n1cnc2c(CCCc3c[nH]c4ccc(OC(=O)CCCCCN)cc34)nc(-c3csc4ccccc34)nc21 |
| InChI | InChI=1S/C33H36N6O2S/c1-21(2)39-20-36-31-28(37-32(38-33(31)39)26-19-42-29-12-6-5-10-24(26)29)11-8-9-22-18-35-27-15-14-23(17-25(22)27)41-30(40)13-4-3-7-16-34/h5-6,10,12,14-15,17-21,35H,3-4,7-9,11,13,16,34H2,1-2H3 |
| InChIKey | XESUKBRWSPHRHH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|