C14H21Cl2N3O2 — CID 44662761
2-[5-(4-azaniumylbutanoyloxy)-1H-indol-3-yl]ethylazanium dichloride (PubChem CID 44662761) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is 2-[5-(4-azaniumylbutanoyloxy)-1H-indol-3-yl]ethylazanium dichloride.
| Compound Name | 2-[5-(4-azaniumylbutanoyloxy)-1H-indol-3-yl]ethylazanium dichloride |
|---|---|
| PubChem CID | 44662761 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[5-(4-azaniumylbutanoyloxy)-1H-indol-3-yl]ethylazanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+]CCCC(=O)Oc1ccc2[nH]cc(CC[NH3+])c2c1 |
| InChI | InChI=1S/C14H19N3O2.2ClH/c15-6-1-2-14(18)19-11-3-4-13-12(8-11)10(5-7-16)9-17-13;;/h3-4,8-9,17H,1-2,5-7,15-16H2;2*1H |
| InChIKey | PECHFKDJEWUCPG-UHFFFAOYSA-N |
| XLogP | -6.11 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|