C41H48FN9O3 — CID 138546424
[3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] 8-[4-(4-aminophenyl)butanoylamino]octanoate (PubChem CID 138546424) has the molecular formula C41H48FN9O3 and a molecular weight of 733.89 g/mol. Its IUPAC name is [3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] 8-[4-(4-aminophenyl)butanoylamino]octanoate.
| Compound Name | [3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] 8-[4-(4-aminophenyl)butanoylamino]octanoate |
|---|---|
| PubChem CID | 138546424 |
| Molecular Formula | C41H48FN9O3 |
| Molecular Weight | 733.89 g/mol |
| Exact Mass | 733.39 |
| IUPAC Name | [3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] 8-[4-(4-aminophenyl)butanoylamino]octanoate |
| SMILES | CC(C)n1cnc2c(NCCc3c[nH]c4ccc(OC(=O)CCCCCCCNC(=O)CCCc5ccc(N)cc5)cc34)nc(-c3cncc(F)c3)nc21 |
| InChI | InChI=1S/C41H48FN9O3/c1-27(2)51-26-48-38-40(49-39(50-41(38)51)30-21-31(42)25-44-23-30)46-20-18-29-24-47-35-17-16-33(22-34(29)35)54-37(53)11-6-4-3-5-7-19-45-36(52)10-8-9-28-12-14-32(43)15-13-28/h12-17,21-27,47H,3-11,18-20,43H2,1-2H3,(H,45,52)(H,46,49,50) |
| InChIKey | PVQGOXNNNAKCHK-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.89 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|