C31H34FN7O2 — CID 138546426
[3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] (E)-oct-2-enoate (PubChem CID 138546426) has the molecular formula C31H34FN7O2 and a molecular weight of 555.66 g/mol. Its IUPAC name is [3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] (E)-oct-2-enoate.
| Compound Name | [3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] (E)-oct-2-enoate |
|---|---|
| PubChem CID | 138546426 |
| Molecular Formula | C31H34FN7O2 |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | [3-[2-[[2-(5-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]-1H-indol-5-yl] (E)-oct-2-enoate |
| SMILES | CCCCC/C=C/C(=O)Oc1ccc2[nH]cc(CCNc3nc(-c4cncc(F)c4)nc4c3ncn4C(C)C)c2c1 |
| InChI | InChI=1S/C31H34FN7O2/c1-4-5-6-7-8-9-27(40)41-24-10-11-26-25(15-24)21(17-35-26)12-13-34-30-28-31(39(19-36-28)20(2)3)38-29(37-30)22-14-23(32)18-33-16-22/h8-11,14-20,35H,4-7,12-13H2,1-3H3,(H,34,37,38)/b9-8+ |
| InChIKey | YSRLXLLRFCZDQO-CMDGGOBGSA-N |
| XLogP | 6.79 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|