C14H13N3S — CID 116827364
5-(1-benzothiophen-3-yl)-N-cyclopropyl-1H-pyrazol-3-amine (PubChem CID 116827364) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 5-(1-benzothiophen-3-yl)-N-cyclopropyl-1H-pyrazol-3-amine.
| Compound Name | 5-(1-benzothiophen-3-yl)-N-cyclopropyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 116827364 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-(1-benzothiophen-3-yl)-N-cyclopropyl-1H-pyrazol-3-amine |
| SMILES | c1ccc2c(-c3cc(NC4CC4)n[nH]3)csc2c1 |
| InChI | InChI=1S/C14H13N3S/c1-2-4-13-10(3-1)11(8-18-13)12-7-14(17-16-12)15-9-5-6-9/h1-4,7-9H,5-6H2,(H2,15,16,17) |
| InChIKey | GVSHATJGHKRJEH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |