C25H26N4S — CID 117084596
2-(1-benzothiophen-3-yl)-N-(1-benzylpiperidin-4-yl)-6-methylpyrimidin-4-amine (PubChem CID 117084596) has the molecular formula C25H26N4S and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-(1-benzylpiperidin-4-yl)-6-methylpyrimidin-4-amine.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-(1-benzylpiperidin-4-yl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 117084596 |
| Molecular Formula | C25H26N4S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-(1-benzylpiperidin-4-yl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCN(Cc3ccccc3)CC2)nc(-c2csc3ccccc23)n1 |
| InChI | InChI=1S/C25H26N4S/c1-18-15-24(28-25(26-18)22-17-30-23-10-6-5-9-21(22)23)27-20-11-13-29(14-12-20)16-19-7-3-2-4-8-19/h2-10,15,17,20H,11-14,16H2,1H3,(H,26,27,28) |
| InChIKey | PEYDHUNTDPRCKH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |