C21H23N3OS — CID 2813504
1-(1-benzothiophen-3-yl)-3-(1-benzylpiperidin-4-yl)urea (PubChem CID 2813504) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-(1-benzylpiperidin-4-yl)urea.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-(1-benzylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 2813504 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-(1-benzylpiperidin-4-yl)urea |
| SMILES | O=C(Nc1csc2ccccc12)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3OS/c25-21(23-19-15-26-20-9-5-4-8-18(19)20)22-17-10-12-24(13-11-17)14-16-6-2-1-3-7-16/h1-9,15,17H,10-14H2,(H2,22,23,25) |
| InChIKey | SSIWESSMTNRQRI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |