C15H15N3S — CID 116877405
N-[[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]methyl]cyclopropanamine (PubChem CID 116877405) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 116877405 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-[[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]methyl]cyclopropanamine |
| SMILES | c1ccc2c(-c3cnc(CNC4CC4)[nH]3)csc2c1 |
| InChI | InChI=1S/C15H15N3S/c1-2-4-14-11(3-1)12(9-19-14)13-7-17-15(18-13)8-16-10-5-6-10/h1-4,7,9-10,16H,5-6,8H2,(H,17,18) |
| InChIKey | GXBLAQNBNMWUPU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |