C25H18N6S — CID 117091216
2-(1-benzothiophen-3-yl)-9-phenyl-N-(pyridin-3-ylmethyl)purin-6-amine (PubChem CID 117091216) has the molecular formula C25H18N6S and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-9-phenyl-N-(pyridin-3-ylmethyl)purin-6-amine.
| Compound Name | 2-(1-benzothiophen-3-yl)-9-phenyl-N-(pyridin-3-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 117091216 |
| Molecular Formula | C25H18N6S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-9-phenyl-N-(pyridin-3-ylmethyl)purin-6-amine |
| SMILES | c1ccc(-n2cnc3c(NCc4cccnc4)nc(-c4csc5ccccc45)nc32)cc1 |
| InChI | InChI=1S/C25H18N6S/c1-2-8-18(9-3-1)31-16-28-22-24(27-14-17-7-6-12-26-13-17)29-23(30-25(22)31)20-15-32-21-11-5-4-10-19(20)21/h1-13,15-16H,14H2,(H,27,29,30) |
| InChIKey | DTCRVNRZMPWQMB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |