C19H14N6S — CID 117088964
8-(1-benzothiophen-3-yl)-N-(pyridin-3-ylmethyl)-7H-purin-6-amine (PubChem CID 117088964) has the molecular formula C19H14N6S and a molecular weight of 358.43 g/mol. Its IUPAC name is 8-(1-benzothiophen-3-yl)-N-(pyridin-3-ylmethyl)-7H-purin-6-amine.
| Compound Name | 8-(1-benzothiophen-3-yl)-N-(pyridin-3-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117088964 |
| Molecular Formula | C19H14N6S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 8-(1-benzothiophen-3-yl)-N-(pyridin-3-ylmethyl)-7H-purin-6-amine |
| SMILES | c1cncc(CNc2ncnc3nc(-c4csc5ccccc45)[nH]c23)c1 |
| InChI | InChI=1S/C19H14N6S/c1-2-6-15-13(5-1)14(10-26-15)17-24-16-18(22-11-23-19(16)25-17)21-9-12-4-3-7-20-8-12/h1-8,10-11H,9H2,(H2,21,22,23,24,25) |
| InChIKey | KTCNQUOSANCJCC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |