C20H21N7O3 — CID 117092412
6-N-(pyridin-3-ylmethyl)-8-N-(3,4,5-trimethoxyphenyl)-7H-purine-6,8-diamine (PubChem CID 117092412) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is 6-N-(pyridin-3-ylmethyl)-8-N-(3,4,5-trimethoxyphenyl)-7H-purine-6,8-diamine.
| Compound Name | 6-N-(pyridin-3-ylmethyl)-8-N-(3,4,5-trimethoxyphenyl)-7H-purine-6,8-diamine |
|---|---|
| PubChem CID | 117092412 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 6-N-(pyridin-3-ylmethyl)-8-N-(3,4,5-trimethoxyphenyl)-7H-purine-6,8-diamine |
| SMILES | COc1cc(Nc2nc3ncnc(NCc4cccnc4)c3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N7O3/c1-28-14-7-13(8-15(29-2)17(14)30-3)25-20-26-16-18(23-11-24-19(16)27-20)22-10-12-5-4-6-21-9-12/h4-9,11H,10H2,1-3H3,(H3,22,23,24,25,26,27) |
| InChIKey | MKZHVUAKRGMLFM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |